C24H34+2 — CID 177387798
1,3-bis(dicyclopropylmethyl)adamantane (PubChem CID 177387798) has the molecular formula C24H34+2 and a molecular weight of 322.54 g/mol. Its IUPAC name is 1,3-bis(dicyclopropylmethyl)adamantane.
| Compound Name | 1,3-bis(dicyclopropylmethyl)adamantane |
|---|---|
| PubChem CID | 177387798 |
| Molecular Formula | C24H34+2 |
| Molecular Weight | 322.54 g/mol |
| Exact Mass | 322.26 |
| IUPAC Name | 1,3-bis(dicyclopropylmethyl)adamantane |
| SMILES | C1C2CC3([C+](C4CC4)C4CC4)CC1CC([C+](C1CC1)C1CC1)(C2)C3 |
| InChI | InChI=1S/C24H34/c1-2-17(1)21(18-3-4-18)23-10-15-9-16(11-23)13-24(12-15,14-23)22(19-5-6-19)20-7-8-20/h15-20H,1-14H2/q+2 |
| InChIKey | ZKNSVSRHNQMFPD-UHFFFAOYSA-N |
| XLogP | 6.36 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.54 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|