C26H30N3S2+ — CID 177387931
[4-(5-hexyl-8,15-dithia-3,5-diazatetracyclo[10.3.0.02,6.07,11]pentadeca-1,3,6,9,11,13-hexaen-4-yl)phenyl]-trimethylazanium (PubChem CID 177387931) has the molecular formula C26H30N3S2+ and a molecular weight of 448.68 g/mol. Its IUPAC name is [4-(5-hexyl-8,15-dithia-3,5-diazatetracyclo[10.3.0.02,6.07,11]pentadeca-1,3,6,9,11,13-hexaen-4-yl)phenyl]-trimethylazanium.
| Compound Name | [4-(5-hexyl-8,15-dithia-3,5-diazatetracyclo[10.3.0.02,6.07,11]pentadeca-1,3,6,9,11,13-hexaen-4-yl)phenyl]-trimethylazanium |
|---|---|
| PubChem CID | 177387931 |
| Molecular Formula | C26H30N3S2+ |
| Molecular Weight | 448.68 g/mol |
| Exact Mass | 448.19 |
| IUPAC Name | [4-(5-hexyl-8,15-dithia-3,5-diazatetracyclo[10.3.0.02,6.07,11]pentadeca-1,3,6,9,11,13-hexaen-4-yl)phenyl]-trimethylazanium |
| SMILES | CCCCCCn1c(-c2ccc([N+](C)(C)C)cc2)nc2c3sccc3c3ccsc3c21 |
| InChI | InChI=1S/C26H30N3S2/c1-5-6-7-8-15-28-23-22(24-20(13-16-30-24)21-14-17-31-25(21)23)27-26(28)18-9-11-19(12-10-18)29(2,3)4/h9-14,16-17H,5-8,15H2,1-4H3/q+1 |
| InChIKey | AGIRXKCFBWDGJP-UHFFFAOYSA-N |
| XLogP | 7.91 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.68 |
| LogP ≤ 5 | 7.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_G(9)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|