C20H30N2O2 — CID 177388086
(R)-[(2S,4S,5R)-5-ethyl-1-azabicyclo[2.2.2]octan-2-yl]-(6-methoxy-1,2,3,4-tetrahydroquinolin-4-yl)methanol (PubChem CID 177388086) has the molecular formula C20H30N2O2 and a molecular weight of 330.47 g/mol. Its IUPAC name is (R)-[(2S,4S,5R)-5-ethyl-1-azabicyclo[2.2.2]octan-2-yl]-(6-methoxy-1,2,3,4-tetrahydroquinolin-4-yl)methanol.
| Compound Name | (R)-[(2S,4S,5R)-5-ethyl-1-azabicyclo[2.2.2]octan-2-yl]-(6-methoxy-1,2,3,4-tetrahydroquinolin-4-yl)methanol |
|---|---|
| PubChem CID | 177388086 |
| Molecular Formula | C20H30N2O2 |
| Molecular Weight | 330.47 g/mol |
| Exact Mass | 330.23 |
| IUPAC Name | (R)-[(2S,4S,5R)-5-ethyl-1-azabicyclo[2.2.2]octan-2-yl]-(6-methoxy-1,2,3,4-tetrahydroquinolin-4-yl)methanol |
| SMILES | CC[C@H]1CN2CC[C@H]1C[C@H]2[C@H](O)C1CCNc2ccc(OC)cc21 |
| InChI | InChI=1S/C20H30N2O2/c1-3-13-12-22-9-7-14(13)10-19(22)20(23)16-6-8-21-18-5-4-15(24-2)11-17(16)18/h4-5,11,13-14,16,19-21,23H,3,6-10,12H2,1-2H3/t13-,14-,16?,19-,20+/m0/s1 |
| InChIKey | QTQWPWAFXWCLGS-NDZHVMPHSA-N |
| XLogP | 3.08 |
| TPSA | 44.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.47 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|