C21H30O6 — CID 177392486
(3S,8R,9S,10R,12R,13S,14R,17R)-17-acetyl-3,12,14,17-tetrahydroxy-10,13-dimethyl-1,2,3,4,8,9,11,12,15,16-decahydrocyclopenta[a]phenanthren-7-one (PubChem CID 177392486) has the molecular formula C21H30O6 and a molecular weight of 378.47 g/mol. Its IUPAC name is (3S,8R,9S,10R,12R,13S,14R,17R)-17-acetyl-3,12,14,17-tetrahydroxy-10,13-dimethyl-1,2,3,4,8,9,11,12,15,16-decahydrocyclopenta[a]phenanthren-7-one.
| Compound Name | (3S,8R,9S,10R,12R,13S,14R,17R)-17-acetyl-3,12,14,17-tetrahydroxy-10,13-dimethyl-1,2,3,4,8,9,11,12,15,16-decahydrocyclopenta[a]phenanthren-7-one |
|---|---|
| PubChem CID | 177392486 |
| Molecular Formula | C21H30O6 |
| Molecular Weight | 378.47 g/mol |
| Exact Mass | 378.20 |
| IUPAC Name | (3S,8R,9S,10R,12R,13S,14R,17R)-17-acetyl-3,12,14,17-tetrahydroxy-10,13-dimethyl-1,2,3,4,8,9,11,12,15,16-decahydrocyclopenta[a]phenanthren-7-one |
| SMILES | CC(=O)[C@@]1(O)CC[C@@]2(O)[C@@H]3C(=O)C=C4C[C@@H](O)CC[C@]4(C)[C@H]3C[C@@H](O)[C@@]21C |
| InChI | InChI=1S/C21H30O6/c1-11(22)20(26)6-7-21(27)17-14(10-16(25)19(20,21)3)18(2)5-4-13(23)8-12(18)9-15(17)24/h9,13-14,16-17,23,25-27H,4-8,10H2,1-3H3/t13-,14-,16+,17-,18-,19+,20-,21+/m0/s1 |
| InChIKey | OERXSDPQYPSMLG-XKSNSHDBSA-N |
| XLogP | 0.89 |
| TPSA | 115.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.47 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |