C19H28O4 — CID 68918323
(8R,9R,10R,13R,14R)-3,14,17-trihydroxy-10,13-dimethyl-2,3,4,8,9,11,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-7-one (PubChem CID 68918323) has the molecular formula C19H28O4 and a molecular weight of 320.43 g/mol. Its IUPAC name is (8R,9R,10R,13R,14R)-3,14,17-trihydroxy-10,13-dimethyl-2,3,4,8,9,11,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-7-one.
| Compound Name | (8R,9R,10R,13R,14R)-3,14,17-trihydroxy-10,13-dimethyl-2,3,4,8,9,11,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-7-one |
|---|---|
| PubChem CID | 68918323 |
| Molecular Formula | C19H28O4 |
| Molecular Weight | 320.43 g/mol |
| Exact Mass | 320.20 |
| IUPAC Name | (8R,9R,10R,13R,14R)-3,14,17-trihydroxy-10,13-dimethyl-2,3,4,8,9,11,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-7-one |
| SMILES | C[C@]12CCC(O)CC1=CC(=O)[C@@H]1[C@H]2CC[C@]2(C)C(O)CC[C@@]12O |
| InChI | InChI=1S/C19H28O4/c1-17-6-3-12(20)9-11(17)10-14(21)16-13(17)4-7-18(2)15(22)5-8-19(16,18)23/h10,12-13,15-16,20,22-23H,3-9H2,1-2H3/t12?,13-,15?,16+,17+,18-,19-/m1/s1 |
| InChIKey | YQSGMKPJOSETEO-ZDQOVUPYSA-N |
| XLogP | 1.96 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.43 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |