About CID 177394176
CID 177394176 (PubChem CID 177394176) has the molecular formula C20H12O4
and a molecular weight of 316.31 g/mol.
Molecular Properties
| Compound Name | CID 177394176 |
| PubChem CID | 177394176 |
| Molecular Formula | C20H12O4 |
| Molecular Weight | 316.31 g/mol |
| Exact Mass | 316.07 |
| IUPAC Name | — |
| SMILES | [O]c1c(O)cc(-c2cc(O)c([O])c3ccccc23)c2ccccc12 |
| InChI | InChI=1S/C20H12O4/c21-17-9-15(11-5-1-3-7-13(11)19(17)23)16-10-18(22)20(24)14-8-4-2-6-12(14)16/h1-10,21-22H |
| InChIKey | FHWBNUTUDBNMMQ-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 80.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 316.31 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze CID 177394176 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 177394176?
The IUPAC name of CID 177394176 (CID 177394176) is not available.
What is the SMILES notation for CID 177394176?
The canonical SMILES for CID 177394176 is [O]c1c(O)cc(-c2cc(O)c([O])c3ccccc23)c2ccccc12.
What is the InChIKey of CID 177394176?
The InChIKey is FHWBNUTUDBNMMQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H12O4/c21-17-9-15(11-5-1-3-7-13(11)19(17)23)16-10-18(22)20(24)14-8-4-2-6-12(14)16/h1-10,21-22H.
What are the key properties of CID 177394176?
CID 177394176 has a molecular weight of 316.31 g/mol, XLogP of 5.36, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 177394176 is sourced from PubChem (CID 177394176), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).