C19H16F5NO2 — CID 177395774
[(4-methyl-1-phenylpent-4-enyl)amino] 2,3,4,5,6-pentafluorobenzoate (PubChem CID 177395774) has the molecular formula C19H16F5NO2 and a molecular weight of 385.33 g/mol. Its IUPAC name is [(4-methyl-1-phenylpent-4-enyl)amino] 2,3,4,5,6-pentafluorobenzoate.
| Compound Name | [(4-methyl-1-phenylpent-4-enyl)amino] 2,3,4,5,6-pentafluorobenzoate |
|---|---|
| PubChem CID | 177395774 |
| Molecular Formula | C19H16F5NO2 |
| Molecular Weight | 385.33 g/mol |
| Exact Mass | 385.11 |
| IUPAC Name | [(4-methyl-1-phenylpent-4-enyl)amino] 2,3,4,5,6-pentafluorobenzoate |
| SMILES | C=C(C)CCC(NOC(=O)c1c(F)c(F)c(F)c(F)c1F)c1ccccc1 |
| InChI | InChI=1S/C19H16F5NO2/c1-10(2)8-9-12(11-6-4-3-5-7-11)25-27-19(26)13-14(20)16(22)18(24)17(23)15(13)21/h3-7,12,25H,1,8-9H2,2H3 |
| InChIKey | GSOCXQHRWQDNKB-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.33 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|