C51H37N2+ — CID 177396157
5-methyl-6-[(1E,3E,5E)-5-(5-methyl-11-phenylindeno[2,3-b]quinolin-5-ium-6-ylidene)penta-1,3-dienyl]-11-phenylindeno[2,1-b]quinoline (PubChem CID 177396157) has the molecular formula C51H37N2+ and a molecular weight of 677.87 g/mol. Its IUPAC name is 5-methyl-6-[(1E,3E,5E)-5-(5-methyl-11-phenylindeno[2,3-b]quinolin-5-ium-6-ylidene)penta-1,3-dienyl]-11-phenylindeno[2,1-b]quinoline.
| Compound Name | 5-methyl-6-[(1E,3E,5E)-5-(5-methyl-11-phenylindeno[2,3-b]quinolin-5-ium-6-ylidene)penta-1,3-dienyl]-11-phenylindeno[2,1-b]quinoline |
|---|---|
| PubChem CID | 177396157 |
| Molecular Formula | C51H37N2+ |
| Molecular Weight | 677.87 g/mol |
| Exact Mass | 677.30 |
| IUPAC Name | 5-methyl-6-[(1E,3E,5E)-5-(5-methyl-11-phenylindeno[2,3-b]quinolin-5-ium-6-ylidene)penta-1,3-dienyl]-11-phenylindeno[2,1-b]quinoline |
| SMILES | Cn1c2c(/C=C/C=C/C=C3\c4ccccc4-c4c(-c5ccccc5)c5ccccc5[n+](C)c43)c3ccccc3c-2c(-c2ccccc2)c2ccccc21 |
| InChI | InChI=1S/C51H37N2/c1-52-44-32-18-16-30-42(44)46(34-20-6-3-7-21-34)48-38-26-14-12-24-36(38)40(50(48)52)28-10-5-11-29-41-37-25-13-15-27-39(37)49-47(35-22-8-4-9-23-35)43-31-17-19-33-45(43)53(2)51(41)49/h3-33H,1-2H3/q+1 |
| InChIKey | CCGFSANDHJPBSR-UHFFFAOYSA-N |
| XLogP | 12.43 |
| TPSA | 8.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 677.87 |
| LogP ≤ 5 | 12.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'het_pyridiniums_A(39)', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|