C41H31N2+ — CID 23341909
1-methyl-3-[(E,3Z)-3-(1-methyl-2-phenylbenzo[g]indol-1-ium-3-ylidene)prop-1-enyl]-2-phenylbenzo[g]indole (PubChem CID 23341909) has the molecular formula C41H31N2+ and a molecular weight of 551.71 g/mol. Its IUPAC name is 1-methyl-3-[(E,3Z)-3-(1-methyl-2-phenylbenzo[g]indol-1-ium-3-ylidene)prop-1-enyl]-2-phenylbenzo[g]indole.
| Compound Name | 1-methyl-3-[(E,3Z)-3-(1-methyl-2-phenylbenzo[g]indol-1-ium-3-ylidene)prop-1-enyl]-2-phenylbenzo[g]indole |
|---|---|
| PubChem CID | 23341909 |
| Molecular Formula | C41H31N2+ |
| Molecular Weight | 551.71 g/mol |
| Exact Mass | 551.25 |
| IUPAC Name | 1-methyl-3-[(E,3Z)-3-(1-methyl-2-phenylbenzo[g]indol-1-ium-3-ylidene)prop-1-enyl]-2-phenylbenzo[g]indole |
| SMILES | Cn1c(-c2ccccc2)c(/C=C/C=C2\C(c3ccccc3)=[N+](C)c3c2ccc2ccccc32)c2ccc3ccccc3c21 |
| InChI | InChI=1S/C41H31N2/c1-42-38(30-16-5-3-6-17-30)34(36-26-24-28-14-9-11-20-32(28)40(36)42)22-13-23-35-37-27-25-29-15-10-12-21-33(29)41(37)43(2)39(35)31-18-7-4-8-19-31/h3-27H,1-2H3/q+1 |
| InChIKey | WOSKXQXOSBHDBD-UHFFFAOYSA-N |
| XLogP | 10.03 |
| TPSA | 7.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.71 |
| LogP ≤ 5 | 10.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|