C25H24F3N — CID 177398671
(E)-N,N-dibenzyl-1,1,1-trifluoro-5-phenylpent-2-en-2-amine (PubChem CID 177398671) has the molecular formula C25H24F3N and a molecular weight of 395.47 g/mol. Its IUPAC name is (E)-N,N-dibenzyl-1,1,1-trifluoro-5-phenylpent-2-en-2-amine.
| Compound Name | (E)-N,N-dibenzyl-1,1,1-trifluoro-5-phenylpent-2-en-2-amine |
|---|---|
| PubChem CID | 177398671 |
| Molecular Formula | C25H24F3N |
| Molecular Weight | 395.47 g/mol |
| Exact Mass | 395.19 |
| IUPAC Name | (E)-N,N-dibenzyl-1,1,1-trifluoro-5-phenylpent-2-en-2-amine |
| SMILES | FC(F)(F)/C(=C\CCc1ccccc1)N(Cc1ccccc1)Cc1ccccc1 |
| InChI | InChI=1S/C25H24F3N/c26-25(27,28)24(18-10-17-21-11-4-1-5-12-21)29(19-22-13-6-2-7-14-22)20-23-15-8-3-9-16-23/h1-9,11-16,18H,10,17,19-20H2/b24-18+ |
| InChIKey | FURHFLCIABSRCO-HKOYGPOVSA-N |
| XLogP | 6.77 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.47 |
| LogP ≤ 5 | 6.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |