C20H24N2O5 — CID 177399284
methyl 3-[(3R,3'S,8'R,8'aR)-3'-(hydroxymethyl)-2,5'-dioxospiro[1H-indole-3,1'-2,3,6,7,8,8a-hexahydroindolizine]-8'-yl]propanoate (PubChem CID 177399284) has the molecular formula C20H24N2O5 and a molecular weight of 372.42 g/mol. Its IUPAC name is methyl 3-[(3R,3'S,8'R,8'aR)-3'-(hydroxymethyl)-2,5'-dioxospiro[1H-indole-3,1'-2,3,6,7,8,8a-hexahydroindolizine]-8'-yl]propanoate.
| Compound Name | methyl 3-[(3R,3'S,8'R,8'aR)-3'-(hydroxymethyl)-2,5'-dioxospiro[1H-indole-3,1'-2,3,6,7,8,8a-hexahydroindolizine]-8'-yl]propanoate |
|---|---|
| PubChem CID | 177399284 |
| Molecular Formula | C20H24N2O5 |
| Molecular Weight | 372.42 g/mol |
| Exact Mass | 372.17 |
| IUPAC Name | methyl 3-[(3R,3'S,8'R,8'aR)-3'-(hydroxymethyl)-2,5'-dioxospiro[1H-indole-3,1'-2,3,6,7,8,8a-hexahydroindolizine]-8'-yl]propanoate |
| SMILES | COC(=O)CC[C@H]1CCC(=O)N2[C@H](CO)C[C@]3(C(=O)Nc4ccccc43)[C@@H]12 |
| InChI | InChI=1S/C20H24N2O5/c1-27-17(25)9-7-12-6-8-16(24)22-13(11-23)10-20(18(12)22)14-4-2-3-5-15(14)21-19(20)26/h2-5,12-13,18,23H,6-11H2,1H3,(H,21,26)/t12-,13+,18-,20-/m1/s1 |
| InChIKey | KEYJPPWNEYJEPR-NGVQZCTJSA-N |
| XLogP | 1.20 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.42 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |