C20H25N3O4S — CID 177399914
ethyl 3-[N-(3-ethoxy-3-oxopropyl)-4-[(E)-2-(1,3,4-thiadiazol-2-yl)ethenyl]anilino]propanoate (PubChem CID 177399914) has the molecular formula C20H25N3O4S and a molecular weight of 403.50 g/mol. Its IUPAC name is ethyl 3-[N-(3-ethoxy-3-oxopropyl)-4-[(E)-2-(1,3,4-thiadiazol-2-yl)ethenyl]anilino]propanoate.
| Compound Name | ethyl 3-[N-(3-ethoxy-3-oxopropyl)-4-[(E)-2-(1,3,4-thiadiazol-2-yl)ethenyl]anilino]propanoate |
|---|---|
| PubChem CID | 177399914 |
| Molecular Formula | C20H25N3O4S |
| Molecular Weight | 403.50 g/mol |
| Exact Mass | 403.16 |
| IUPAC Name | ethyl 3-[N-(3-ethoxy-3-oxopropyl)-4-[(E)-2-(1,3,4-thiadiazol-2-yl)ethenyl]anilino]propanoate |
| SMILES | CCOC(=O)CCN(CCC(=O)OCC)c1ccc(/C=C/c2nncs2)cc1 |
| InChI | InChI=1S/C20H25N3O4S/c1-3-26-19(24)11-13-23(14-12-20(25)27-4-2)17-8-5-16(6-9-17)7-10-18-22-21-15-28-18/h5-10,15H,3-4,11-14H2,1-2H3/b10-7+ |
| InChIKey | XDZJICGWFRNDOZ-JXMROGBWSA-N |
| XLogP | 3.42 |
| TPSA | 81.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.50 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'} |
|---|