C16H18N6O5S — CID 102394415
3-[N-(2-carboxyethyl)-3-(methoxymethylideneamino)-4-(1,3,4-thiadiazol-2-yldiazenyl)anilino]propanoic acid (PubChem CID 102394415) has the molecular formula C16H18N6O5S and a molecular weight of 406.42 g/mol. Its IUPAC name is 3-[N-(2-carboxyethyl)-3-(methoxymethylideneamino)-4-(1,3,4-thiadiazol-2-yldiazenyl)anilino]propanoic acid.
| Compound Name | 3-[N-(2-carboxyethyl)-3-(methoxymethylideneamino)-4-(1,3,4-thiadiazol-2-yldiazenyl)anilino]propanoic acid |
|---|---|
| PubChem CID | 102394415 |
| Molecular Formula | C16H18N6O5S |
| Molecular Weight | 406.42 g/mol |
| Exact Mass | 406.11 |
| IUPAC Name | 3-[N-(2-carboxyethyl)-3-(methoxymethylideneamino)-4-(1,3,4-thiadiazol-2-yldiazenyl)anilino]propanoic acid |
| SMILES | CO/C=N/c1cc(N(CCC(=O)O)CCC(=O)O)ccc1/N=N/c1nncs1 |
| InChI | InChI=1S/C16H18N6O5S/c1-27-9-17-13-8-11(22(6-4-14(23)24)7-5-15(25)26)2-3-12(13)19-21-16-20-18-10-28-16/h2-3,8-10H,4-7H2,1H3,(H,23,24)(H,25,26)/b17-9+,21-19+ |
| InChIKey | XYYSAKSZAKRRIV-ZDYCKTBTSA-N |
| XLogP | 3.02 |
| TPSA | 149.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.42 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|