C11H18O5 — CID 177400028
(2S)-2-(5-hydroxyhexyl)-3-methylidenebutanedioic acid (PubChem CID 177400028) has the molecular formula C11H18O5 and a molecular weight of 230.26 g/mol. Its IUPAC name is (2S)-2-(5-hydroxyhexyl)-3-methylidenebutanedioic acid.
| Compound Name | (2S)-2-(5-hydroxyhexyl)-3-methylidenebutanedioic acid |
|---|---|
| PubChem CID | 177400028 |
| Molecular Formula | C11H18O5 |
| Molecular Weight | 230.26 g/mol |
| Exact Mass | 230.12 |
| IUPAC Name | (2S)-2-(5-hydroxyhexyl)-3-methylidenebutanedioic acid |
| SMILES | C=C(C(=O)O)[C@H](CCCCC(C)O)C(=O)O |
| InChI | InChI=1S/C11H18O5/c1-7(12)5-3-4-6-9(11(15)16)8(2)10(13)14/h7,9,12H,2-6H2,1H3,(H,13,14)(H,15,16)/t7?,9-/m0/s1 |
| InChIKey | SPTZQYLKDFWPGO-NETXQHHPSA-N |
| XLogP | 1.27 |
| TPSA | 94.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.26 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|