C7H12O4 — CID 57105026
3,5-dihydroxy-2-methylidenehexanoic acid (PubChem CID 57105026) has the molecular formula C7H12O4 and a molecular weight of 160.17 g/mol. Its IUPAC name is 3,5-dihydroxy-2-methylidenehexanoic acid.
| Compound Name | 3,5-dihydroxy-2-methylidenehexanoic acid |
|---|---|
| PubChem CID | 57105026 |
| Molecular Formula | C7H12O4 |
| Molecular Weight | 160.17 g/mol |
| Exact Mass | 160.07 |
| IUPAC Name | 3,5-dihydroxy-2-methylidenehexanoic acid |
| SMILES | C=C(C(=O)O)C(O)CC(C)O |
| InChI | InChI=1S/C7H12O4/c1-4(8)3-6(9)5(2)7(10)11/h4,6,8-9H,2-3H2,1H3,(H,10,11) |
| InChIKey | QKOKMDIGOQSPJA-UHFFFAOYSA-N |
| XLogP | -0.24 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 160.17 |
| LogP ≤ 5 | -0.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|