C10H12F6O3 — CID 87374229
7,7,7-trifluoro-3-hydroxy-4-methyl-2-methylidene-6-(trifluoromethyl)heptanoic acid (PubChem CID 87374229) has the molecular formula C10H12F6O3 and a molecular weight of 294.19 g/mol. Its IUPAC name is 7,7,7-trifluoro-3-hydroxy-4-methyl-2-methylidene-6-(trifluoromethyl)heptanoic acid.
| Compound Name | 7,7,7-trifluoro-3-hydroxy-4-methyl-2-methylidene-6-(trifluoromethyl)heptanoic acid |
|---|---|
| PubChem CID | 87374229 |
| Molecular Formula | C10H12F6O3 |
| Molecular Weight | 294.19 g/mol |
| Exact Mass | 294.07 |
| IUPAC Name | 7,7,7-trifluoro-3-hydroxy-4-methyl-2-methylidene-6-(trifluoromethyl)heptanoic acid |
| SMILES | C=C(C(=O)O)C(O)C(C)CC(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C10H12F6O3/c1-4(7(17)5(2)8(18)19)3-6(9(11,12)13)10(14,15)16/h4,6-7,17H,2-3H2,1H3,(H,18,19) |
| InChIKey | DAVKFTRSUXQSRG-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.19 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|