C13H11FN2O2 — CID 177400183
N-[(6Z)-4-fluoro-6-(1-hydroxy-2-pyridinylidene)cyclohexa-2,4-dien-1-ylidene]acetamide (PubChem CID 177400183) has the molecular formula C13H11FN2O2 and a molecular weight of 246.24 g/mol. Its IUPAC name is N-[(6Z)-4-fluoro-6-(1-hydroxy-2-pyridinylidene)cyclohexa-2,4-dien-1-ylidene]acetamide.
| Compound Name | N-[(6Z)-4-fluoro-6-(1-hydroxy-2-pyridinylidene)cyclohexa-2,4-dien-1-ylidene]acetamide |
|---|---|
| PubChem CID | 177400183 |
| Molecular Formula | C13H11FN2O2 |
| Molecular Weight | 246.24 g/mol |
| Exact Mass | 246.08 |
| IUPAC Name | N-[(6Z)-4-fluoro-6-(1-hydroxy-2-pyridinylidene)cyclohexa-2,4-dien-1-ylidene]acetamide |
| SMILES | CC(=O)/N=C1\C=CC(F)=C\C1=C1/C=CC=CN1O |
| InChI | InChI=1S/C13H11FN2O2/c1-9(17)15-12-6-5-10(14)8-11(12)13-4-2-3-7-16(13)18/h2-8,18H,1H3/b13-11-,15-12+ |
| InChIKey | VVWIZOAFMMLJLK-OWTZWGKBSA-N |
| XLogP | 2.43 |
| TPSA | 52.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.24 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|