C23H31N5O8 — CID 177400812
4-ethynyl-6-[[4,7,10-tris(carboxymethyl)-1,4,7,10-tetrazacyclododec-1-yl]methyl]pyridine-2-carboxylic acid (PubChem CID 177400812) has the molecular formula C23H31N5O8 and a molecular weight of 505.53 g/mol. Its IUPAC name is 4-ethynyl-6-[[4,7,10-tris(carboxymethyl)-1,4,7,10-tetrazacyclododec-1-yl]methyl]pyridine-2-carboxylic acid.
| Compound Name | 4-ethynyl-6-[[4,7,10-tris(carboxymethyl)-1,4,7,10-tetrazacyclododec-1-yl]methyl]pyridine-2-carboxylic acid |
|---|---|
| PubChem CID | 177400812 |
| Molecular Formula | C23H31N5O8 |
| Molecular Weight | 505.53 g/mol |
| Exact Mass | 505.22 |
| IUPAC Name | 4-ethynyl-6-[[4,7,10-tris(carboxymethyl)-1,4,7,10-tetrazacyclododec-1-yl]methyl]pyridine-2-carboxylic acid |
| SMILES | C#Cc1cc(CN2CCN(CC(=O)O)CCN(CC(=O)O)CCN(CC(=O)O)CC2)nc(C(=O)O)c1 |
| InChI | InChI=1S/C23H31N5O8/c1-2-17-11-18(24-19(12-17)23(35)36)13-25-3-5-26(14-20(29)30)7-9-28(16-22(33)34)10-8-27(6-4-25)15-21(31)32/h1,11-12H,3-10,13-16H2,(H,29,30)(H,31,32)(H,33,34)(H,35,36) |
| InChIKey | NPZDMQZZFBOQQN-UHFFFAOYSA-N |
| XLogP | -1.26 |
| TPSA | 175.05 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.53 |
| LogP ≤ 5 | -1.26 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|