C55H50O10 — CID 177401720
4,9,14,19,24-pentamethoxy-26,28,30,32,34-pentakis(prop-2-ynoxy)hexacyclo[21.2.2.23,6.28,11.213,16.218,21]pentatriaconta-1(25),3,5,8,10,13,15,18,20,23,26,28,30,32,34-pentadecaene (PubChem CID 177401720) has the molecular formula C55H50O10 and a molecular weight of 870.99 g/mol. Its IUPAC name is 4,9,14,19,24-pentamethoxy-26,28,30,32,34-pentakis(prop-2-ynoxy)hexacyclo[21.2.2.23,6.28,11.213,16.218,21]pentatriaconta-1(25),3,5,8,10,13,15,18,20,23,26,28,30,32,34-pentadecaene.
| Compound Name | 4,9,14,19,24-pentamethoxy-26,28,30,32,34-pentakis(prop-2-ynoxy)hexacyclo[21.2.2.23,6.28,11.213,16.218,21]pentatriaconta-1(25),3,5,8,10,13,15,18,20,23,26,28,30,32,34-pentadecaene |
|---|---|
| PubChem CID | 177401720 |
| Molecular Formula | C55H50O10 |
| Molecular Weight | 870.99 g/mol |
| Exact Mass | 870.34 |
| IUPAC Name | 4,9,14,19,24-pentamethoxy-26,28,30,32,34-pentakis(prop-2-ynoxy)hexacyclo[21.2.2.23,6.28,11.213,16.218,21]pentatriaconta-1(25),3,5,8,10,13,15,18,20,23,26,28,30,32,34-pentadecaene |
| SMILES | C#CCOc1cc2c(OC)cc1Cc1cc(OCC#C)c(cc1OC)Cc1cc(OCC#C)c(cc1OC)Cc1cc(OCC#C)c(cc1OC)Cc1cc(OCC#C)c(cc1OC)C2 |
| InChI | InChI=1S/C55H50O10/c1-11-16-61-51-31-36-22-42-27-48(58-8)38(33-53(42)63-18-13-3)24-44-29-50(60-10)40(35-55(44)65-20-15-5)25-45-30-49(59-9)39(34-54(45)64-19-14-4)23-43-28-47(57-7)37(32-52(43)62-17-12-2)21-41(51)26-46(36)56-6/h1-5,26-35H,16-25H2,6-10H3 |
| InChIKey | GATJYAJLDCKCOX-UHFFFAOYSA-N |
| XLogP | 8.06 |
| TPSA | 92.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 65 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 870.99 |
| LogP ≤ 5 | 8.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|