C13H18F2O4 — CID 177401803
methyl (2Z)-2-[3,3-difluoro-2-hydroxy-2-(2-methylbut-3-en-2-yl)oxan-4-ylidene]acetate (PubChem CID 177401803) has the molecular formula C13H18F2O4 and a molecular weight of 276.28 g/mol. Its IUPAC name is methyl (2Z)-2-[3,3-difluoro-2-hydroxy-2-(2-methylbut-3-en-2-yl)oxan-4-ylidene]acetate.
| Compound Name | methyl (2Z)-2-[3,3-difluoro-2-hydroxy-2-(2-methylbut-3-en-2-yl)oxan-4-ylidene]acetate |
|---|---|
| PubChem CID | 177401803 |
| Molecular Formula | C13H18F2O4 |
| Molecular Weight | 276.28 g/mol |
| Exact Mass | 276.12 |
| IUPAC Name | methyl (2Z)-2-[3,3-difluoro-2-hydroxy-2-(2-methylbut-3-en-2-yl)oxan-4-ylidene]acetate |
| SMILES | C=CC(C)(C)C1(O)OCC/C(=C/C(=O)OC)C1(F)F |
| InChI | InChI=1S/C13H18F2O4/c1-5-11(2,3)13(17)12(14,15)9(6-7-19-13)8-10(16)18-4/h5,8,17H,1,6-7H2,2-4H3/b9-8- |
| InChIKey | JEONIOYRQDZHOQ-HJWRWDBZSA-N |
| XLogP | 2.04 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.28 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|