C21H32F2O7 — CID 132603404
[(2R,3R)-4-[(2S,4E,6S)-5,5-difluoro-6-hydroxy-4-(2-methoxy-2-oxoethylidene)-6-(2-methylbut-3-en-2-yl)oxan-2-yl]-3-hydroxybutan-2-yl] butanoate (PubChem CID 132603404) has the molecular formula C21H32F2O7 and a molecular weight of 434.48 g/mol. Its IUPAC name is [(2R,3R)-4-[(2S,4E,6S)-5,5-difluoro-6-hydroxy-4-(2-methoxy-2-oxoethylidene)-6-(2-methylbut-3-en-2-yl)oxan-2-yl]-3-hydroxybutan-2-yl] butanoate.
| Compound Name | [(2R,3R)-4-[(2S,4E,6S)-5,5-difluoro-6-hydroxy-4-(2-methoxy-2-oxoethylidene)-6-(2-methylbut-3-en-2-yl)oxan-2-yl]-3-hydroxybutan-2-yl] butanoate |
|---|---|
| PubChem CID | 132603404 |
| Molecular Formula | C21H32F2O7 |
| Molecular Weight | 434.48 g/mol |
| Exact Mass | 434.21 |
| IUPAC Name | [(2R,3R)-4-[(2S,4E,6S)-5,5-difluoro-6-hydroxy-4-(2-methoxy-2-oxoethylidene)-6-(2-methylbut-3-en-2-yl)oxan-2-yl]-3-hydroxybutan-2-yl] butanoate |
| SMILES | C=CC(C)(C)[C@]1(O)O[C@H](C[C@@H](O)[C@@H](C)OC(=O)CCC)C/C(=C\C(=O)OC)C1(F)F |
| InChI | InChI=1S/C21H32F2O7/c1-7-9-17(25)29-13(3)16(24)12-15-10-14(11-18(26)28-6)20(22,23)21(27,30-15)19(4,5)8-2/h8,11,13,15-16,24,27H,2,7,9-10,12H2,1,3-6H3/b14-11+/t13-,15+,16-,21+/m1/s1 |
| InChIKey | GHYUDOOKZXNHDQ-CRPBMOMFSA-N |
| XLogP | 2.89 |
| TPSA | 102.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.48 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|