C30H52O8Si — CID 102401629
methyl (2E)-2-[(2S,3S,6S)-3-acetyloxy-2-hydroxy-6-[(2R,3R)-2-hydroxy-3-triethylsilyloxybutyl]-2-[(3E)-2-methylnona-3,8-dien-2-yl]oxan-4-ylidene]acetate (PubChem CID 102401629) has the molecular formula C30H52O8Si and a molecular weight of 568.82 g/mol. Its IUPAC name is methyl (2E)-2-[(2S,3S,6S)-3-acetyloxy-2-hydroxy-6-[(2R,3R)-2-hydroxy-3-triethylsilyloxybutyl]-2-[(3E)-2-methylnona-3,8-dien-2-yl]oxan-4-ylidene]acetate.
| Compound Name | methyl (2E)-2-[(2S,3S,6S)-3-acetyloxy-2-hydroxy-6-[(2R,3R)-2-hydroxy-3-triethylsilyloxybutyl]-2-[(3E)-2-methylnona-3,8-dien-2-yl]oxan-4-ylidene]acetate |
|---|---|
| PubChem CID | 102401629 |
| Molecular Formula | C30H52O8Si |
| Molecular Weight | 568.82 g/mol |
| Exact Mass | 568.34 |
| IUPAC Name | methyl (2E)-2-[(2S,3S,6S)-3-acetyloxy-2-hydroxy-6-[(2R,3R)-2-hydroxy-3-triethylsilyloxybutyl]-2-[(3E)-2-methylnona-3,8-dien-2-yl]oxan-4-ylidene]acetate |
| SMILES | C=CCCC/C=C/C(C)(C)[C@]1(O)O[C@H](C[C@@H](O)[C@@H](C)O[Si](CC)(CC)CC)C/C(=C\C(=O)OC)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C30H52O8Si/c1-10-14-15-16-17-18-29(7,8)30(34)28(36-23(6)31)24(20-27(33)35-9)19-25(37-30)21-26(32)22(5)38-39(11-2,12-3)13-4/h10,17-18,20,22,25-26,28,32,34H,1,11-16,19,21H2,2-9H3/b18-17+,24-20+/t22-,25+,26-,28+,30-/m1/s1 |
| InChIKey | QHOFGBHWHDSJPU-WXKFEUKZSA-N |
| XLogP | 5.59 |
| TPSA | 111.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.82 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|