C17H26F2O6 — CID 132603406
methyl (2E)-2-[(2S,6S)-6-[(2R,3R)-2,3-dihydroxybutyl]-3,3-difluoro-2-hydroxy-2-(2-methylbut-3-en-2-yl)oxan-4-ylidene]acetate (PubChem CID 132603406) has the molecular formula C17H26F2O6 and a molecular weight of 364.39 g/mol. Its IUPAC name is methyl (2E)-2-[(2S,6S)-6-[(2R,3R)-2,3-dihydroxybutyl]-3,3-difluoro-2-hydroxy-2-(2-methylbut-3-en-2-yl)oxan-4-ylidene]acetate.
| Compound Name | methyl (2E)-2-[(2S,6S)-6-[(2R,3R)-2,3-dihydroxybutyl]-3,3-difluoro-2-hydroxy-2-(2-methylbut-3-en-2-yl)oxan-4-ylidene]acetate |
|---|---|
| PubChem CID | 132603406 |
| Molecular Formula | C17H26F2O6 |
| Molecular Weight | 364.39 g/mol |
| Exact Mass | 364.17 |
| IUPAC Name | methyl (2E)-2-[(2S,6S)-6-[(2R,3R)-2,3-dihydroxybutyl]-3,3-difluoro-2-hydroxy-2-(2-methylbut-3-en-2-yl)oxan-4-ylidene]acetate |
| SMILES | C=CC(C)(C)[C@]1(O)O[C@H](C[C@@H](O)[C@@H](C)O)C/C(=C\C(=O)OC)C1(F)F |
| InChI | InChI=1S/C17H26F2O6/c1-6-15(3,4)17(23)16(18,19)11(8-14(22)24-5)7-12(25-17)9-13(21)10(2)20/h6,8,10,12-13,20-21,23H,1,7,9H2,2-5H3/b11-8+/t10-,12+,13-,17+/m1/s1 |
| InChIKey | LVDPHAUZXHQOCB-TYGRKBDXSA-N |
| XLogP | 1.54 |
| TPSA | 96.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.39 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|