C20H32O6 — CID 59116782
[(2S,4E,6S)-4-ethylidene-2-hydroxy-6-[(2R)-2-hydroxy-3-methylbutyl]-2-[(E)-2-methyl-5-oxopent-3-en-2-yl]oxan-3-yl] acetate (PubChem CID 59116782) has the molecular formula C20H32O6 and a molecular weight of 368.47 g/mol. Its IUPAC name is [(2S,4E,6S)-4-ethylidene-2-hydroxy-6-[(2R)-2-hydroxy-3-methylbutyl]-2-[(E)-2-methyl-5-oxopent-3-en-2-yl]oxan-3-yl] acetate.
| Compound Name | [(2S,4E,6S)-4-ethylidene-2-hydroxy-6-[(2R)-2-hydroxy-3-methylbutyl]-2-[(E)-2-methyl-5-oxopent-3-en-2-yl]oxan-3-yl] acetate |
|---|---|
| PubChem CID | 59116782 |
| Molecular Formula | C20H32O6 |
| Molecular Weight | 368.47 g/mol |
| Exact Mass | 368.22 |
| IUPAC Name | [(2S,4E,6S)-4-ethylidene-2-hydroxy-6-[(2R)-2-hydroxy-3-methylbutyl]-2-[(E)-2-methyl-5-oxopent-3-en-2-yl]oxan-3-yl] acetate |
| SMILES | C/C=C1\C[C@@H](C[C@@H](O)C(C)C)O[C@@](O)(C(C)(C)/C=C/C=O)C1OC(C)=O |
| InChI | InChI=1S/C20H32O6/c1-7-15-11-16(12-17(23)13(2)3)26-20(24,18(15)25-14(4)22)19(5,6)9-8-10-21/h7-10,13,16-18,23-24H,11-12H2,1-6H3/b9-8+,15-7+/t16-,17+,18?,20+/m0/s1 |
| InChIKey | BLHZDIPIOOTNTP-FUDZKZKUSA-N |
| XLogP | 2.53 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.47 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|