C64H74N2Se — CID 177402130
3,6-ditert-butyl-1-(4-tert-butylphenyl)-8-[5-[3,6-ditert-butyl-8-(4-tert-butylphenyl)-9H-carbazol-1-yl]selenophen-2-yl]-9H-carbazole (PubChem CID 177402130) has the molecular formula C64H74N2Se and a molecular weight of 950.27 g/mol. Its IUPAC name is 3,6-ditert-butyl-1-(4-tert-butylphenyl)-8-[5-[3,6-ditert-butyl-8-(4-tert-butylphenyl)-9H-carbazol-1-yl]selenophen-2-yl]-9H-carbazole.
| Compound Name | 3,6-ditert-butyl-1-(4-tert-butylphenyl)-8-[5-[3,6-ditert-butyl-8-(4-tert-butylphenyl)-9H-carbazol-1-yl]selenophen-2-yl]-9H-carbazole |
|---|---|
| PubChem CID | 177402130 |
| Molecular Formula | C64H74N2Se |
| Molecular Weight | 950.27 g/mol |
| Exact Mass | 950.50 |
| IUPAC Name | 3,6-ditert-butyl-1-(4-tert-butylphenyl)-8-[5-[3,6-ditert-butyl-8-(4-tert-butylphenyl)-9H-carbazol-1-yl]selenophen-2-yl]-9H-carbazole |
| SMILES | CC(C)(C)c1ccc(-c2cc(C(C)(C)C)cc3c2[nH]c2c(-c4ccc(-c5cc(C(C)(C)C)cc6c5[nH]c5c(-c7ccc(C(C)(C)C)cc7)cc(C(C)(C)C)cc56)[se]4)cc(C(C)(C)C)cc23)cc1 |
| InChI | InChI=1S/C64H74N2Se/c1-59(2,3)39-23-19-37(20-24-39)45-29-41(61(7,8)9)31-47-49-33-43(63(13,14)15)35-51(57(49)65-55(45)47)53-27-28-54(67-53)52-36-44(64(16,17)18)34-50-48-32-42(62(10,11)12)30-46(56(48)66-58(50)52)38-21-25-40(26-22-38)60(4,5)6/h19-36,65-66H,1-18H3 |
| InChIKey | NMAFHDHSZNQWJW-UHFFFAOYSA-N |
| XLogP | 18.47 |
| TPSA | 31.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 67 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 950.27 |
| LogP ≤ 5 | 18.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|