C19H21NO4 — CID 177404427
(1R,12R,13R)-16-methoxy-20-methyl-5,7-dioxa-20-azapentacyclo[10.5.3.01,13.02,10.04,8]icosa-2,4(8),9,16-tetraen-15-one (PubChem CID 177404427) has the molecular formula C19H21NO4 and a molecular weight of 327.38 g/mol. Its IUPAC name is (1R,12R,13R)-16-methoxy-20-methyl-5,7-dioxa-20-azapentacyclo[10.5.3.01,13.02,10.04,8]icosa-2,4(8),9,16-tetraen-15-one.
| Compound Name | (1R,12R,13R)-16-methoxy-20-methyl-5,7-dioxa-20-azapentacyclo[10.5.3.01,13.02,10.04,8]icosa-2,4(8),9,16-tetraen-15-one |
|---|---|
| PubChem CID | 177404427 |
| Molecular Formula | C19H21NO4 |
| Molecular Weight | 327.38 g/mol |
| Exact Mass | 327.15 |
| IUPAC Name | (1R,12R,13R)-16-methoxy-20-methyl-5,7-dioxa-20-azapentacyclo[10.5.3.01,13.02,10.04,8]icosa-2,4(8),9,16-tetraen-15-one |
| SMILES | COC1=C[C@]23CCN(C)[C@H](Cc4cc5c(cc42)OCO5)[C@@H]3CC1=O |
| InChI | InChI=1S/C19H21NO4/c1-20-4-3-19-9-18(22-2)15(21)7-13(19)14(20)5-11-6-16-17(8-12(11)19)24-10-23-16/h6,8-9,13-14H,3-5,7,10H2,1-2H3/t13-,14+,19+/m0/s1 |
| InChIKey | CQOIKQRNRZTGLJ-IQUTYRLHSA-N |
| XLogP | 2.03 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.38 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |