C28H24AlNO2S — CID 177405418
1-(benzenesulfonyl)-2-methyl-3,4,5-triphenyl-5H-azalumole (PubChem CID 177405418) has the molecular formula C28H24AlNO2S and a molecular weight of 465.55 g/mol. Its IUPAC name is 1-(benzenesulfonyl)-2-methyl-3,4,5-triphenyl-5H-azalumole.
| Compound Name | 1-(benzenesulfonyl)-2-methyl-3,4,5-triphenyl-5H-azalumole |
|---|---|
| PubChem CID | 177405418 |
| Molecular Formula | C28H24AlNO2S |
| Molecular Weight | 465.55 g/mol |
| Exact Mass | 465.13 |
| IUPAC Name | 1-(benzenesulfonyl)-2-methyl-3,4,5-triphenyl-5H-azalumole |
| SMILES | C[Al]1C(c2ccccc2)=C(c2ccccc2)C(c2ccccc2)N1S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C27H21NO2S.CH3.Al/c29-31(30,25-19-11-4-12-20-25)28-27(24-17-9-3-10-18-24)26(23-15-7-2-8-16-23)21-22-13-5-1-6-14-22;;/h1-20,27H;1H3;/q-1;;+1 |
| InChIKey | YLFCEQDHXJYMPZ-UHFFFAOYSA-N |
| XLogP | 6.20 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.55 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|