C8H10N2O — CID 177405657
(3E)-3-(aminomethylidene)-5-(methyliminomethyl)cyclopenta-1,4-dien-1-ol (PubChem CID 177405657) has the molecular formula C8H10N2O and a molecular weight of 150.18 g/mol. Its IUPAC name is (3E)-3-(aminomethylidene)-5-(methyliminomethyl)cyclopenta-1,4-dien-1-ol.
| Compound Name | (3E)-3-(aminomethylidene)-5-(methyliminomethyl)cyclopenta-1,4-dien-1-ol |
|---|---|
| PubChem CID | 177405657 |
| Molecular Formula | C8H10N2O |
| Molecular Weight | 150.18 g/mol |
| Exact Mass | 150.08 |
| IUPAC Name | (3E)-3-(aminomethylidene)-5-(methyliminomethyl)cyclopenta-1,4-dien-1-ol |
| SMILES | C/N=C/C1=C/C(=C\N)C=C1O |
| InChI | InChI=1S/C8H10N2O/c1-10-5-7-2-6(4-9)3-8(7)11/h2-5,11H,9H2,1H3/b6-4+,10-5+ |
| InChIKey | YGKKZSAQECJLGE-GQYICFGZSA-N |
| XLogP | 0.91 |
| TPSA | 58.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 150.18 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|