C16H27N2O2+ — CID 123283256
ethane;[(Z)-2-[2-[[(2Z)-2-ethylidene-3-hydroxy-4-methylpent-3-enylidene]amino]-1-hydroxyethenyl]but-2-enylidene]azanium (PubChem CID 123283256) has the molecular formula C16H27N2O2+ and a molecular weight of 279.40 g/mol. Its IUPAC name is ethane;[(Z)-2-[2-[[(2Z)-2-ethylidene-3-hydroxy-4-methylpent-3-enylidene]amino]-1-hydroxyethenyl]but-2-enylidene]azanium.
| Compound Name | ethane;[(Z)-2-[2-[[(2Z)-2-ethylidene-3-hydroxy-4-methylpent-3-enylidene]amino]-1-hydroxyethenyl]but-2-enylidene]azanium |
|---|---|
| PubChem CID | 123283256 |
| Molecular Formula | C16H27N2O2+ |
| Molecular Weight | 279.40 g/mol |
| Exact Mass | 279.21 |
| IUPAC Name | ethane;[(Z)-2-[2-[[(2Z)-2-ethylidene-3-hydroxy-4-methylpent-3-enylidene]amino]-1-hydroxyethenyl]but-2-enylidene]azanium |
| SMILES | C/C=C(/C=[NH2+])C(O)=C/N=C/C(=C/C)C(O)=C(C)C.CC |
| InChI | InChI=1S/C14H20N2O2.C2H6/c1-5-11(7-15)13(17)9-16-8-12(6-2)14(18)10(3)4;1-2/h5-9,15,17-18H,1-4H3;1-2H3/p+1/b11-5-,12-6-,13-9?,15-7?,16-8+; |
| InChIKey | DDOQFCUVWMBJSW-CCAGBZKSSA-O |
| XLogP | 3.06 |
| TPSA | 78.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.40 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|