C16H26N2O2 — CID 123572869
(2Z,4Z,6E,8Z)-3,8-bis(methyliminomethyl)deca-2,4,6,8-tetraene-4,7-diol;ethane (PubChem CID 123572869) has the molecular formula C16H26N2O2 and a molecular weight of 278.40 g/mol. Its IUPAC name is (2Z,4Z,6E,8Z)-3,8-bis(methyliminomethyl)deca-2,4,6,8-tetraene-4,7-diol;ethane.
| Compound Name | (2Z,4Z,6E,8Z)-3,8-bis(methyliminomethyl)deca-2,4,6,8-tetraene-4,7-diol;ethane |
|---|---|
| PubChem CID | 123572869 |
| Molecular Formula | C16H26N2O2 |
| Molecular Weight | 278.40 g/mol |
| Exact Mass | 278.20 |
| IUPAC Name | (2Z,4Z,6E,8Z)-3,8-bis(methyliminomethyl)deca-2,4,6,8-tetraene-4,7-diol;ethane |
| SMILES | C/C=C(/C=N/C)C(\O)=C\C=C(O)/C(=C\C)/C=N/C.CC |
| InChI | InChI=1S/C14H20N2O2.C2H6/c1-5-11(9-15-3)13(17)7-8-14(18)12(6-2)10-16-4;1-2/h5-10,17-18H,1-4H3;1-2H3/b11-5-,12-6-,13-7-,14-8+,15-9+,16-10+; |
| InChIKey | YLDLAGRZPRCJMU-ABINTPQWSA-N |
| XLogP | 4.19 |
| TPSA | 65.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.40 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|