C11H17NO — CID 176975574
acetylene;(2E,4E)-5-(methyliminomethyl)hepta-2,4-dien-3-ol (PubChem CID 176975574) has the molecular formula C11H17NO and a molecular weight of 179.26 g/mol. Its IUPAC name is acetylene;(2E,4E)-5-(methyliminomethyl)hepta-2,4-dien-3-ol.
| Compound Name | acetylene;(2E,4E)-5-(methyliminomethyl)hepta-2,4-dien-3-ol |
|---|---|
| PubChem CID | 176975574 |
| Molecular Formula | C11H17NO |
| Molecular Weight | 179.26 g/mol |
| Exact Mass | 179.13 |
| IUPAC Name | acetylene;(2E,4E)-5-(methyliminomethyl)hepta-2,4-dien-3-ol |
| SMILES | C#C.C/C=C(O)\C=C(\C=N\C)CC |
| InChI | InChI=1S/C9H15NO.C2H2/c1-4-8(7-10-3)6-9(11)5-2;1-2/h5-7,11H,4H2,1-3H3;1-2H/b8-6+,9-5+,10-7+; |
| InChIKey | WLKQVKUDTUWKJJ-UOMWJVDTSA-N |
| XLogP | 2.73 |
| TPSA | 32.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.26 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|