C29H43N3O3 — CID 177408305
4,4-dimethyl-2-[[2,4,6-trimethyl-3,5-bis[[(4S)-4-propan-2-yl-4,5-dihydro-1,3-oxazol-2-yl]methyl]phenyl]methyl]-5H-1,3-oxazole (PubChem CID 177408305) has the molecular formula C29H43N3O3 and a molecular weight of 481.68 g/mol. Its IUPAC name is 4,4-dimethyl-2-[[2,4,6-trimethyl-3,5-bis[[(4S)-4-propan-2-yl-4,5-dihydro-1,3-oxazol-2-yl]methyl]phenyl]methyl]-5H-1,3-oxazole.
| Compound Name | 4,4-dimethyl-2-[[2,4,6-trimethyl-3,5-bis[[(4S)-4-propan-2-yl-4,5-dihydro-1,3-oxazol-2-yl]methyl]phenyl]methyl]-5H-1,3-oxazole |
|---|---|
| PubChem CID | 177408305 |
| Molecular Formula | C29H43N3O3 |
| Molecular Weight | 481.68 g/mol |
| Exact Mass | 481.33 |
| IUPAC Name | 4,4-dimethyl-2-[[2,4,6-trimethyl-3,5-bis[[(4S)-4-propan-2-yl-4,5-dihydro-1,3-oxazol-2-yl]methyl]phenyl]methyl]-5H-1,3-oxazole |
| SMILES | Cc1c(CC2=N[C@@H](C(C)C)CO2)c(C)c(CC2=NC(C)(C)CO2)c(C)c1CC1=N[C@@H](C(C)C)CO1 |
| InChI | InChI=1S/C29H43N3O3/c1-16(2)24-13-33-26(30-24)10-21-18(5)22(11-27-31-25(14-34-27)17(3)4)20(7)23(19(21)6)12-28-32-29(8,9)15-35-28/h16-17,24-25H,10-15H2,1-9H3/t24-,25-/m1/s1 |
| InChIKey | XPCUGOMUOLYEKM-JWQCQUIFSA-N |
| XLogP | 5.35 |
| TPSA | 64.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.68 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |