C42H48N2O4 — CID 177409542
(4E)-4-[(3,3-dibutyl-5-carboxy-1-ethylindol-1-ium-2-yl)methylidene]-2-[(E)-(1-hexylbenzo[cd]indol-2-ylidene)methyl]-3-oxocyclobuten-1-olate (PubChem CID 177409542) has the molecular formula C42H48N2O4 and a molecular weight of 644.86 g/mol. Its IUPAC name is (4E)-4-[(3,3-dibutyl-5-carboxy-1-ethylindol-1-ium-2-yl)methylidene]-2-[(E)-(1-hexylbenzo[cd]indol-2-ylidene)methyl]-3-oxocyclobuten-1-olate.
| Compound Name | (4E)-4-[(3,3-dibutyl-5-carboxy-1-ethylindol-1-ium-2-yl)methylidene]-2-[(E)-(1-hexylbenzo[cd]indol-2-ylidene)methyl]-3-oxocyclobuten-1-olate |
|---|---|
| PubChem CID | 177409542 |
| Molecular Formula | C42H48N2O4 |
| Molecular Weight | 644.86 g/mol |
| Exact Mass | 644.36 |
| IUPAC Name | (4E)-4-[(3,3-dibutyl-5-carboxy-1-ethylindol-1-ium-2-yl)methylidene]-2-[(E)-(1-hexylbenzo[cd]indol-2-ylidene)methyl]-3-oxocyclobuten-1-olate |
| SMILES | CCCCCCn1/c(=C/C2=C([O-])/C(=C\C3=[N+](CC)c4ccc(C(=O)O)cc4C3(CCCC)CCCC)C2=O)c2cccc3cccc1c32 |
| InChI | InChI=1S/C42H48N2O4/c1-5-9-12-13-24-44-35-19-15-17-28-16-14-18-30(38(28)35)36(44)26-31-39(45)32(40(31)46)27-37-42(22-10-6-2,23-11-7-3)33-25-29(41(47)48)20-21-34(33)43(37)8-4/h14-21,25-27H,5-13,22-24H2,1-4H3,(H-,45,46,47,48) |
| InChIKey | HLPVYEDDAXUZHV-UHFFFAOYSA-N |
| XLogP | 8.13 |
| TPSA | 85.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 644.86 |
| LogP ≤ 5 | 8.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|