C37H32N2O3 — CID 163790501
5-(benzo[cd]indol-2-ylmethylidene)-4-hydroxy-3-[(1-octylbenzo[cd]indol-2-ylidene)methyl]cyclopent-3-ene-1,2-dione (PubChem CID 163790501) has the molecular formula C37H32N2O3 and a molecular weight of 552.67 g/mol. Its IUPAC name is 5-(benzo[cd]indol-2-ylmethylidene)-4-hydroxy-3-[(1-octylbenzo[cd]indol-2-ylidene)methyl]cyclopent-3-ene-1,2-dione.
| Compound Name | 5-(benzo[cd]indol-2-ylmethylidene)-4-hydroxy-3-[(1-octylbenzo[cd]indol-2-ylidene)methyl]cyclopent-3-ene-1,2-dione |
|---|---|
| PubChem CID | 163790501 |
| Molecular Formula | C37H32N2O3 |
| Molecular Weight | 552.67 g/mol |
| Exact Mass | 552.24 |
| IUPAC Name | 5-(benzo[cd]indol-2-ylmethylidene)-4-hydroxy-3-[(1-octylbenzo[cd]indol-2-ylidene)methyl]cyclopent-3-ene-1,2-dione |
| SMILES | CCCCCCCCn1c(=CC2=C(O)C(=CC3=Nc4cccc5cccc3c45)C(=O)C2=O)c2cccc3cccc1c32 |
| InChI | InChI=1S/C37H32N2O3/c1-2-3-4-5-6-7-20-39-31-19-11-15-24-13-9-17-26(34(24)31)32(39)22-28-35(40)27(36(41)37(28)42)21-30-25-16-8-12-23-14-10-18-29(38-30)33(23)25/h8-19,21-22,40H,2-7,20H2,1H3 |
| InChIKey | REJOJPRPKTXNPF-UHFFFAOYSA-N |
| XLogP | 7.83 |
| TPSA | 71.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.67 |
| LogP ≤ 5 | 7.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|