C17H20N5O2+ — CID 177410049
ethyl N-(1-benzyl-5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-4-ium-2-yl)carbamate (PubChem CID 177410049) has the molecular formula C17H20N5O2+ and a molecular weight of 326.38 g/mol. Its IUPAC name is ethyl N-(1-benzyl-5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-4-ium-2-yl)carbamate.
| Compound Name | ethyl N-(1-benzyl-5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-4-ium-2-yl)carbamate |
|---|---|
| PubChem CID | 177410049 |
| Molecular Formula | C17H20N5O2+ |
| Molecular Weight | 326.38 g/mol |
| Exact Mass | 326.16 |
| IUPAC Name | ethyl N-(1-benzyl-5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-4-ium-2-yl)carbamate |
| SMILES | CCOC(=O)NC1=NC2=[N+]=C(C)C=C(C)N2N1Cc1ccccc1 |
| InChI | InChI=1S/C17H19N5O2/c1-4-24-17(23)20-15-19-16-18-12(2)10-13(3)22(16)21(15)11-14-8-6-5-7-9-14/h5-10H,4,11H2,1-3H3/p+1 |
| InChIKey | TUYVYGAGYADPOP-UHFFFAOYSA-O |
| XLogP | 1.62 |
| TPSA | 71.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.38 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|