C13H16N4O2S — CID 10517757
ethyl N-(4-benzyl-5-methylimino-1,3,4-thiadiazol-2-yl)carbamate (PubChem CID 10517757) has the molecular formula C13H16N4O2S and a molecular weight of 292.36 g/mol. Its IUPAC name is ethyl N-(4-benzyl-5-methylimino-1,3,4-thiadiazol-2-yl)carbamate.
| Compound Name | ethyl N-(4-benzyl-5-methylimino-1,3,4-thiadiazol-2-yl)carbamate |
|---|---|
| PubChem CID | 10517757 |
| Molecular Formula | C13H16N4O2S |
| Molecular Weight | 292.36 g/mol |
| Exact Mass | 292.10 |
| IUPAC Name | ethyl N-(4-benzyl-5-methylimino-1,3,4-thiadiazol-2-yl)carbamate |
| SMILES | CCOC(=O)Nc1nn(Cc2ccccc2)/c(=N/C)s1 |
| InChI | InChI=1S/C13H16N4O2S/c1-3-19-13(18)15-11-16-17(12(14-2)20-11)9-10-7-5-4-6-8-10/h4-8H,3,9H2,1-2H3,(H,15,16,18)/b14-12- |
| InChIKey | ZBQVYGUQYCVLKQ-OWBHPGMISA-N |
| XLogP | 2.09 |
| TPSA | 68.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.36 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |