C17H16N4OS — CID 10711113
N-(4-benzyl-5-methylimino-1,3,4-thiadiazol-2-yl)benzamide (PubChem CID 10711113) has the molecular formula C17H16N4OS and a molecular weight of 324.41 g/mol. Its IUPAC name is N-(4-benzyl-5-methylimino-1,3,4-thiadiazol-2-yl)benzamide.
| Compound Name | N-(4-benzyl-5-methylimino-1,3,4-thiadiazol-2-yl)benzamide |
|---|---|
| PubChem CID | 10711113 |
| Molecular Formula | C17H16N4OS |
| Molecular Weight | 324.41 g/mol |
| Exact Mass | 324.10 |
| IUPAC Name | N-(4-benzyl-5-methylimino-1,3,4-thiadiazol-2-yl)benzamide |
| SMILES | C/N=c1\sc(NC(=O)c2ccccc2)nn1Cc1ccccc1 |
| InChI | InChI=1S/C17H16N4OS/c1-18-17-21(12-13-8-4-2-5-9-13)20-16(23-17)19-15(22)14-10-6-3-7-11-14/h2-11H,12H2,1H3,(H,19,20,22)/b18-17- |
| InChIKey | JDVFNTFXPVHTCI-ZCXUNETKSA-N |
| XLogP | 2.78 |
| TPSA | 59.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.41 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |