C18H24N4O4 — CID 59517463
ethyl 3-benzyl-5-[2-[(2-methylpropan-2-yl)oxycarbonyl]hydrazinyl]imidazole-4-carboxylate (PubChem CID 59517463) has the molecular formula C18H24N4O4 and a molecular weight of 360.41 g/mol. Its IUPAC name is ethyl 3-benzyl-5-[2-[(2-methylpropan-2-yl)oxycarbonyl]hydrazinyl]imidazole-4-carboxylate.
| Compound Name | ethyl 3-benzyl-5-[2-[(2-methylpropan-2-yl)oxycarbonyl]hydrazinyl]imidazole-4-carboxylate |
|---|---|
| PubChem CID | 59517463 |
| Molecular Formula | C18H24N4O4 |
| Molecular Weight | 360.41 g/mol |
| Exact Mass | 360.18 |
| IUPAC Name | ethyl 3-benzyl-5-[2-[(2-methylpropan-2-yl)oxycarbonyl]hydrazinyl]imidazole-4-carboxylate |
| SMILES | CCOC(=O)c1c(NNC(=O)OC(C)(C)C)ncn1Cc1ccccc1 |
| InChI | InChI=1S/C18H24N4O4/c1-5-25-16(23)14-15(20-21-17(24)26-18(2,3)4)19-12-22(14)11-13-9-7-6-8-10-13/h6-10,12,20H,5,11H2,1-4H3,(H,21,24) |
| InChIKey | WGZSPDXAEJAWEM-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 94.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.41 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|