C21H17Cl4N — CID 177411541
N-benzyl-N-[2,2,2-trichloro-1-(4-chlorophenyl)ethyl]aniline (PubChem CID 177411541) has the molecular formula C21H17Cl4N and a molecular weight of 425.19 g/mol. Its IUPAC name is N-benzyl-N-[2,2,2-trichloro-1-(4-chlorophenyl)ethyl]aniline.
| Compound Name | N-benzyl-N-[2,2,2-trichloro-1-(4-chlorophenyl)ethyl]aniline |
|---|---|
| PubChem CID | 177411541 |
| Molecular Formula | C21H17Cl4N |
| Molecular Weight | 425.19 g/mol |
| Exact Mass | 423.01 |
| IUPAC Name | N-benzyl-N-[2,2,2-trichloro-1-(4-chlorophenyl)ethyl]aniline |
| SMILES | Clc1ccc(C(N(Cc2ccccc2)c2ccccc2)C(Cl)(Cl)Cl)cc1 |
| InChI | InChI=1S/C21H17Cl4N/c22-18-13-11-17(12-14-18)20(21(23,24)25)26(19-9-5-2-6-10-19)15-16-7-3-1-4-8-16/h1-14,20H,15H2 |
| InChIKey | KHBKPNMERVKSHL-UHFFFAOYSA-N |
| XLogP | 7.46 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.19 |
| LogP ≤ 5 | 7.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|