About N-benzyl-N-[2,2,2-trichloro-1-(4-chlorophenyl)ethyl]aniline
N-benzyl-N-[2,2,2-trichloro-1-(4-chlorophenyl)ethyl]aniline (PubChem CID 177411541) has the molecular formula C21H17Cl4N
and a molecular weight of 425.19 g/mol. Its IUPAC name is N-benzyl-N-[2,2,2-trichloro-1-(4-chlorophenyl)ethyl]aniline.
Molecular Properties
| Compound Name | N-benzyl-N-[2,2,2-trichloro-1-(4-chlorophenyl)ethyl]aniline |
| PubChem CID | 177411541 |
| Molecular Formula | C21H17Cl4N |
| Molecular Weight | 425.19 g/mol |
| Exact Mass | 423.01 |
| IUPAC Name | N-benzyl-N-[2,2,2-trichloro-1-(4-chlorophenyl)ethyl]aniline |
| SMILES | Clc1ccc(C(N(Cc2ccccc2)c2ccccc2)C(Cl)(Cl)Cl)cc1 |
| InChI | InChI=1S/C21H17Cl4N/c22-18-13-11-17(12-14-18)20(21(23,24)25)26(19-9-5-2-6-10-19)15-16-7-3-1-4-8-16/h1-14,20H,15H2 |
| InChIKey | KHBKPNMERVKSHL-UHFFFAOYSA-N |
| XLogP | 7.46 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 425.19 |
| LogP ≤ 5 | 7.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze N-benzyl-N-[2,2,2-trichloro-1-(4-chlorophenyl)ethyl]aniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-benzyl-N-[2,2,2-trichloro-1-(4-chlorophenyl)ethyl]aniline?
The IUPAC name of N-benzyl-N-[2,2,2-trichloro-1-(4-chlorophenyl)ethyl]aniline (CID 177411541) is N-benzyl-N-[2,2,2-trichloro-1-(4-chlorophenyl)ethyl]aniline.
What is the SMILES notation for N-benzyl-N-[2,2,2-trichloro-1-(4-chlorophenyl)ethyl]aniline?
The canonical SMILES for N-benzyl-N-[2,2,2-trichloro-1-(4-chlorophenyl)ethyl]aniline is Clc1ccc(C(N(Cc2ccccc2)c2ccccc2)C(Cl)(Cl)Cl)cc1.
What is the InChIKey of N-benzyl-N-[2,2,2-trichloro-1-(4-chlorophenyl)ethyl]aniline?
The InChIKey is KHBKPNMERVKSHL-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H17Cl4N/c22-18-13-11-17(12-14-18)20(21(23,24)25)26(19-9-5-2-6-10-19)15-16-7-3-1-4-8-16/h1-14,20H,15H2.
What are the key properties of N-benzyl-N-[2,2,2-trichloro-1-(4-chlorophenyl)ethyl]aniline?
N-benzyl-N-[2,2,2-trichloro-1-(4-chlorophenyl)ethyl]aniline has a molecular weight of 425.19 g/mol, XLogP of 7.46, 5 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-benzyl-N-[2,2,2-trichloro-1-(4-chlorophenyl)ethyl]aniline is sourced from PubChem (CID 177411541), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).