C23H20Cl2N2 — CID 7036264
(3R)-2,2-dichloro-3-(dibenzylamino)-3-phenylpropanenitrile (PubChem CID 7036264) has the molecular formula C23H20Cl2N2 and a molecular weight of 395.33 g/mol. Its IUPAC name is (3R)-2,2-dichloro-3-(dibenzylamino)-3-phenylpropanenitrile.
| Compound Name | (3R)-2,2-dichloro-3-(dibenzylamino)-3-phenylpropanenitrile |
|---|---|
| PubChem CID | 7036264 |
| Molecular Formula | C23H20Cl2N2 |
| Molecular Weight | 395.33 g/mol |
| Exact Mass | 394.10 |
| IUPAC Name | (3R)-2,2-dichloro-3-(dibenzylamino)-3-phenylpropanenitrile |
| SMILES | N#CC(Cl)(Cl)[C@@H](c1ccccc1)N(Cc1ccccc1)Cc1ccccc1 |
| InChI | InChI=1S/C23H20Cl2N2/c24-23(25,18-26)22(21-14-8-3-9-15-21)27(16-19-10-4-1-5-11-19)17-20-12-6-2-7-13-20/h1-15,22H,16-17H2/t22-/m1/s1 |
| InChIKey | VWNFQMMJAZMEDY-JOCHJYFZSA-N |
| XLogP | 6.13 |
| TPSA | 27.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.33 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|