C16H23NO3 — CID 177413449
(1R,2R,13R,15S)-2,10-dihydroxy-15-methyl-6-azatetracyclo[7.7.0.01,6.02,13]hexadec-9-en-11-one (PubChem CID 177413449) has the molecular formula C16H23NO3 and a molecular weight of 277.36 g/mol. Its IUPAC name is (1R,2R,13R,15S)-2,10-dihydroxy-15-methyl-6-azatetracyclo[7.7.0.01,6.02,13]hexadec-9-en-11-one.
| Compound Name | (1R,2R,13R,15S)-2,10-dihydroxy-15-methyl-6-azatetracyclo[7.7.0.01,6.02,13]hexadec-9-en-11-one |
|---|---|
| PubChem CID | 177413449 |
| Molecular Formula | C16H23NO3 |
| Molecular Weight | 277.36 g/mol |
| Exact Mass | 277.17 |
| IUPAC Name | (1R,2R,13R,15S)-2,10-dihydroxy-15-methyl-6-azatetracyclo[7.7.0.01,6.02,13]hexadec-9-en-11-one |
| SMILES | C[C@H]1C[C@@H]2CC(=O)C(O)=C3CCN4CCC[C@]2(O)[C@@]34C1 |
| InChI | InChI=1S/C16H23NO3/c1-10-7-11-8-13(18)14(19)12-3-6-17-5-2-4-16(11,20)15(12,17)9-10/h10-11,19-20H,2-9H2,1H3/t10-,11+,15+,16+/m0/s1 |
| InChIKey | GUHDXXGJMVTAEM-IRHXVLAXSA-N |
| XLogP | 1.79 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.36 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |