C21H33NO3 — CID 135067265
tert-butyl (1S)-4-methyl-2-oxo-13-azatricyclo[7.7.0.01,6]hexadec-8-ene-13-carboxylate (PubChem CID 135067265) has the molecular formula C21H33NO3 and a molecular weight of 347.50 g/mol. Its IUPAC name is tert-butyl (1S)-4-methyl-2-oxo-13-azatricyclo[7.7.0.01,6]hexadec-8-ene-13-carboxylate.
| Compound Name | tert-butyl (1S)-4-methyl-2-oxo-13-azatricyclo[7.7.0.01,6]hexadec-8-ene-13-carboxylate |
|---|---|
| PubChem CID | 135067265 |
| Molecular Formula | C21H33NO3 |
| Molecular Weight | 347.50 g/mol |
| Exact Mass | 347.25 |
| IUPAC Name | tert-butyl (1S)-4-methyl-2-oxo-13-azatricyclo[7.7.0.01,6]hexadec-8-ene-13-carboxylate |
| SMILES | CC1CC(=O)[C@]23CCCN(C(=O)OC(C)(C)C)CCCC2=CCC3C1 |
| InChI | InChI=1S/C21H33NO3/c1-15-13-17-9-8-16-7-5-11-22(19(24)25-20(2,3)4)12-6-10-21(16,17)18(23)14-15/h8,15,17H,5-7,9-14H2,1-4H3/t15?,17?,21-/m1/s1 |
| InChIKey | TUFVJSSDMHOJFH-AEJJIKPWSA-N |
| XLogP | 4.73 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.50 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|