C24H43NO5Si — CID 71559459
tert-butyl (1S,3R,5S,6R)-3-methyl-7-oxo-1-(2-oxoethyl)-5-trimethylsilyloxy-11-azaspiro[5.8]tetradecane-11-carboxylate (PubChem CID 71559459) has the molecular formula C24H43NO5Si and a molecular weight of 453.70 g/mol. Its IUPAC name is tert-butyl (1S,3R,5S,6R)-3-methyl-7-oxo-1-(2-oxoethyl)-5-trimethylsilyloxy-11-azaspiro[5.8]tetradecane-11-carboxylate.
| Compound Name | tert-butyl (1S,3R,5S,6R)-3-methyl-7-oxo-1-(2-oxoethyl)-5-trimethylsilyloxy-11-azaspiro[5.8]tetradecane-11-carboxylate |
|---|---|
| PubChem CID | 71559459 |
| Molecular Formula | C24H43NO5Si |
| Molecular Weight | 453.70 g/mol |
| Exact Mass | 453.29 |
| IUPAC Name | tert-butyl (1S,3R,5S,6R)-3-methyl-7-oxo-1-(2-oxoethyl)-5-trimethylsilyloxy-11-azaspiro[5.8]tetradecane-11-carboxylate |
| SMILES | C[C@@H]1C[C@@H](CC=O)[C@]2(CCCN(C(=O)OC(C)(C)C)CCCC2=O)[C@@H](O[Si](C)(C)C)C1 |
| InChI | InChI=1S/C24H43NO5Si/c1-18-16-19(11-15-26)24(21(17-18)30-31(5,6)7)12-9-14-25(13-8-10-20(24)27)22(28)29-23(2,3)4/h15,18-19,21H,8-14,16-17H2,1-7H3/t18-,19-,21+,24+/m1/s1 |
| InChIKey | FREPSPKQEAJFOW-OBFMXLEASA-N |
| XLogP | 5.21 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.70 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|