C30H55NO4Si — CID 135019841
tert-butyl (9R)-4-methyl-8-oxo-2-tri(propan-2-yl)silyloxy-13-azatricyclo[7.7.0.01,6]hexadecane-13-carboxylate (PubChem CID 135019841) has the molecular formula C30H55NO4Si and a molecular weight of 521.86 g/mol. Its IUPAC name is tert-butyl (9R)-4-methyl-8-oxo-2-tri(propan-2-yl)silyloxy-13-azatricyclo[7.7.0.01,6]hexadecane-13-carboxylate.
| Compound Name | tert-butyl (9R)-4-methyl-8-oxo-2-tri(propan-2-yl)silyloxy-13-azatricyclo[7.7.0.01,6]hexadecane-13-carboxylate |
|---|---|
| PubChem CID | 135019841 |
| Molecular Formula | C30H55NO4Si |
| Molecular Weight | 521.86 g/mol |
| Exact Mass | 521.39 |
| IUPAC Name | tert-butyl (9R)-4-methyl-8-oxo-2-tri(propan-2-yl)silyloxy-13-azatricyclo[7.7.0.01,6]hexadecane-13-carboxylate |
| SMILES | CC1CC2CC(=O)[C@@H]3CCCN(C(=O)OC(C)(C)C)CCCC23C(O[Si](C(C)C)(C(C)C)C(C)C)C1 |
| InChI | InChI=1S/C30H55NO4Si/c1-20(2)36(21(3)4,22(5)6)35-27-18-23(7)17-24-19-26(32)25-13-11-15-31(16-12-14-30(24,25)27)28(33)34-29(8,9)10/h20-25,27H,11-19H2,1-10H3/t23?,24?,25-,27?,30?/m0/s1 |
| InChIKey | CKWLGXHQPGADMM-UVZVOWGESA-N |
| XLogP | 7.98 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.86 |
| LogP ≤ 5 | 7.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|