C23H41NO6 — CID 53348720
tert-butyl (1R,2S,4R,6S,8S,9R)-8,9-dihydroxy-2-(methoxymethoxy)-4-methyl-13-azatricyclo[7.7.0.01,6]hexadecane-13-carboxylate (PubChem CID 53348720) has the molecular formula C23H41NO6 and a molecular weight of 427.58 g/mol. Its IUPAC name is tert-butyl (1R,2S,4R,6S,8S,9R)-8,9-dihydroxy-2-(methoxymethoxy)-4-methyl-13-azatricyclo[7.7.0.01,6]hexadecane-13-carboxylate.
| Compound Name | tert-butyl (1R,2S,4R,6S,8S,9R)-8,9-dihydroxy-2-(methoxymethoxy)-4-methyl-13-azatricyclo[7.7.0.01,6]hexadecane-13-carboxylate |
|---|---|
| PubChem CID | 53348720 |
| Molecular Formula | C23H41NO6 |
| Molecular Weight | 427.58 g/mol |
| Exact Mass | 427.29 |
| IUPAC Name | tert-butyl (1R,2S,4R,6S,8S,9R)-8,9-dihydroxy-2-(methoxymethoxy)-4-methyl-13-azatricyclo[7.7.0.01,6]hexadecane-13-carboxylate |
| SMILES | COCO[C@H]1C[C@H](C)C[C@H]2C[C@H](O)[C@@]3(O)CCCN(C(=O)OC(C)(C)C)CCC[C@@]213 |
| InChI | InChI=1S/C23H41NO6/c1-16-12-17-14-18(25)23(27)9-7-11-24(20(26)30-21(2,3)4)10-6-8-22(17,23)19(13-16)29-15-28-5/h16-19,25,27H,6-15H2,1-5H3/t16-,17+,18+,19+,22-,23+/m1/s1 |
| InChIKey | OVALQVLCFUBRRQ-XQNYPUBSSA-N |
| XLogP | 3.31 |
| TPSA | 88.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.58 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|