C21H35NO5 — CID 139091865
tert-butyl (1S,2S,10S,11R,13S,15R)-10,13-dihydroxy-15-methyl-12-oxa-6-azatetracyclo[9.5.1.02,10.02,13]heptadecane-6-carboxylate (PubChem CID 139091865) has the molecular formula C21H35NO5 and a molecular weight of 381.51 g/mol. Its IUPAC name is tert-butyl (1S,2S,10S,11R,13S,15R)-10,13-dihydroxy-15-methyl-12-oxa-6-azatetracyclo[9.5.1.02,10.02,13]heptadecane-6-carboxylate.
| Compound Name | tert-butyl (1S,2S,10S,11R,13S,15R)-10,13-dihydroxy-15-methyl-12-oxa-6-azatetracyclo[9.5.1.02,10.02,13]heptadecane-6-carboxylate |
|---|---|
| PubChem CID | 139091865 |
| Molecular Formula | C21H35NO5 |
| Molecular Weight | 381.51 g/mol |
| Exact Mass | 381.25 |
| IUPAC Name | tert-butyl (1S,2S,10S,11R,13S,15R)-10,13-dihydroxy-15-methyl-12-oxa-6-azatetracyclo[9.5.1.02,10.02,13]heptadecane-6-carboxylate |
| SMILES | C[C@@H]1C[C@H]2C[C@H]3O[C@@](O)(C1)[C@@]21CCCN(C(=O)OC(C)(C)C)CCC[C@@]31O |
| InChI | InChI=1S/C21H35NO5/c1-14-11-15-12-16-20(24)8-6-10-22(17(23)27-18(2,3)4)9-5-7-19(15,20)21(25,13-14)26-16/h14-16,24-25H,5-13H2,1-4H3/t14-,15+,16-,19+,20-,21+/m1/s1 |
| InChIKey | BAFKJDJUZRNFOY-GOLBOHCDSA-N |
| XLogP | 3.05 |
| TPSA | 79.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.51 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |