C16H19NO3 — CID 177491579
(1S,2R,13R,15R)-2-hydroxy-15-methyl-6-azatetracyclo[8.6.0.01,6.02,13]hexadeca-7,9-diene-11,12-dione (PubChem CID 177491579) has the molecular formula C16H19NO3 and a molecular weight of 273.33 g/mol. Its IUPAC name is (1S,2R,13R,15R)-2-hydroxy-15-methyl-6-azatetracyclo[8.6.0.01,6.02,13]hexadeca-7,9-diene-11,12-dione.
| Compound Name | (1S,2R,13R,15R)-2-hydroxy-15-methyl-6-azatetracyclo[8.6.0.01,6.02,13]hexadeca-7,9-diene-11,12-dione |
|---|---|
| PubChem CID | 177491579 |
| Molecular Formula | C16H19NO3 |
| Molecular Weight | 273.33 g/mol |
| Exact Mass | 273.14 |
| IUPAC Name | (1S,2R,13R,15R)-2-hydroxy-15-methyl-6-azatetracyclo[8.6.0.01,6.02,13]hexadeca-7,9-diene-11,12-dione |
| SMILES | C[C@@H]1C[C@H]2C(=O)C(=O)C3=CC=CN4CCC[C@]2(O)[C@]34C1 |
| InChI | InChI=1S/C16H19NO3/c1-10-8-12-14(19)13(18)11-4-2-6-17-7-3-5-16(12,20)15(11,17)9-10/h2,4,6,10,12,20H,3,5,7-9H2,1H3/t10-,12+,15+,16-/m1/s1 |
| InChIKey | RKKUMJNJOIBLOP-WJCKQCIISA-N |
| XLogP | 1.20 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.33 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|