C14H23NO6 — CID 177415652
methyl (3aR,4R,6aS)-4-(acetyloxymethyl)-2,2-diethyl-3a,4,6,6a-tetrahydro-[1,3]dioxolo[4,5-c]pyrrole-5-carboxylate (PubChem CID 177415652) has the molecular formula C14H23NO6 and a molecular weight of 301.34 g/mol. Its IUPAC name is methyl (3aR,4R,6aS)-4-(acetyloxymethyl)-2,2-diethyl-3a,4,6,6a-tetrahydro-[1,3]dioxolo[4,5-c]pyrrole-5-carboxylate.
| Compound Name | methyl (3aR,4R,6aS)-4-(acetyloxymethyl)-2,2-diethyl-3a,4,6,6a-tetrahydro-[1,3]dioxolo[4,5-c]pyrrole-5-carboxylate |
|---|---|
| PubChem CID | 177415652 |
| Molecular Formula | C14H23NO6 |
| Molecular Weight | 301.34 g/mol |
| Exact Mass | 301.15 |
| IUPAC Name | methyl (3aR,4R,6aS)-4-(acetyloxymethyl)-2,2-diethyl-3a,4,6,6a-tetrahydro-[1,3]dioxolo[4,5-c]pyrrole-5-carboxylate |
| SMILES | CCC1(CC)O[C@H]2[C@H](CN(C(=O)OC)[C@@H]2COC(C)=O)O1 |
| InChI | InChI=1S/C14H23NO6/c1-5-14(6-2)20-11-7-15(13(17)18-4)10(12(11)21-14)8-19-9(3)16/h10-12H,5-8H2,1-4H3/t10-,11+,12-/m1/s1 |
| InChIKey | QKBBPLPQIXWOJX-GRYCIOLGSA-N |
| XLogP | 1.30 |
| TPSA | 74.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.34 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |