C34H30N4O4 — CID 177416686
(2S)-N-[(E)-(2-hydroxyphenyl)methylideneamino]-3-(1H-indol-3-yl)-2-[[2-[4-[(E)-2-phenylethenyl]phenoxy]acetyl]amino]propanamide (PubChem CID 177416686) has the molecular formula C34H30N4O4 and a molecular weight of 558.64 g/mol. Its IUPAC name is (2S)-N-[(E)-(2-hydroxyphenyl)methylideneamino]-3-(1H-indol-3-yl)-2-[[2-[4-[(E)-2-phenylethenyl]phenoxy]acetyl]amino]propanamide.
| Compound Name | (2S)-N-[(E)-(2-hydroxyphenyl)methylideneamino]-3-(1H-indol-3-yl)-2-[[2-[4-[(E)-2-phenylethenyl]phenoxy]acetyl]amino]propanamide |
|---|---|
| PubChem CID | 177416686 |
| Molecular Formula | C34H30N4O4 |
| Molecular Weight | 558.64 g/mol |
| Exact Mass | 558.23 |
| IUPAC Name | (2S)-N-[(E)-(2-hydroxyphenyl)methylideneamino]-3-(1H-indol-3-yl)-2-[[2-[4-[(E)-2-phenylethenyl]phenoxy]acetyl]amino]propanamide |
| SMILES | O=C(COc1ccc(/C=C/c2ccccc2)cc1)N[C@@H](Cc1c[nH]c2ccccc12)C(=O)N/N=C/c1ccccc1O |
| InChI | InChI=1S/C34H30N4O4/c39-32-13-7-4-10-26(32)22-36-38-34(41)31(20-27-21-35-30-12-6-5-11-29(27)30)37-33(40)23-42-28-18-16-25(17-19-28)15-14-24-8-2-1-3-9-24/h1-19,21-22,31,35,39H,20,23H2,(H,37,40)(H,38,41)/b15-14+,36-22+/t31-/m0/s1 |
| InChIKey | QHEBCUXLCZMFCY-QBUITWBOSA-N |
| XLogP | 5.30 |
| TPSA | 115.81 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.64 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|