C22H18BIN2 — CID 177418003
3-(3-iodo-5,8-dimethylnaphthalen-2-yl)-2,4-diaza-3-boratricyclo[7.3.1.05,13]trideca-1(12),5,7,9(13),10-pentaene (PubChem CID 177418003) has the molecular formula C22H18BIN2 and a molecular weight of 448.12 g/mol. Its IUPAC name is 3-(3-iodo-5,8-dimethylnaphthalen-2-yl)-2,4-diaza-3-boratricyclo[7.3.1.05,13]trideca-1(12),5,7,9(13),10-pentaene.
| Compound Name | 3-(3-iodo-5,8-dimethylnaphthalen-2-yl)-2,4-diaza-3-boratricyclo[7.3.1.05,13]trideca-1(12),5,7,9(13),10-pentaene |
|---|---|
| PubChem CID | 177418003 |
| Molecular Formula | C22H18BIN2 |
| Molecular Weight | 448.12 g/mol |
| Exact Mass | 448.06 |
| IUPAC Name | 3-(3-iodo-5,8-dimethylnaphthalen-2-yl)-2,4-diaza-3-boratricyclo[7.3.1.05,13]trideca-1(12),5,7,9(13),10-pentaene |
| SMILES | Cc1ccc(C)c2cc(B3Nc4cccc5cccc(c45)N3)c(I)cc12 |
| InChI | InChI=1S/C22H18BIN2/c1-13-9-10-14(2)17-12-19(24)18(11-16(13)17)23-25-20-7-3-5-15-6-4-8-21(26-23)22(15)20/h3-12,25-26H,1-2H3 |
| InChIKey | PDQMUARKNIFUNV-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.12 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|